C28H27NO5 — CID 10182867
7-hydroxy-4-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-phenylchromen-2-one (PubChem CID 10182867) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is 7-hydroxy-4-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-phenylchromen-2-one.
| Compound Name | 7-hydroxy-4-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-phenylchromen-2-one |
|---|---|
| PubChem CID | 10182867 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 7-hydroxy-4-[[4-(2-morpholin-4-ylethoxy)phenyl]methyl]-3-phenylchromen-2-one |
| SMILES | O=c1oc2cc(O)ccc2c(Cc2ccc(OCCN3CCOCC3)cc2)c1-c1ccccc1 |
| InChI | InChI=1S/C28H27NO5/c30-22-8-11-24-25(27(21-4-2-1-3-5-21)28(31)34-26(24)19-22)18-20-6-9-23(10-7-20)33-17-14-29-12-15-32-16-13-29/h1-11,19,30H,12-18H2 |
| InChIKey | SXKPNCHRRCINGH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|