C27H25NO4S — CID 18410284
(6-hydroxy-2-phenyl-1-benzothiophen-3-yl)-[4-(2-morpholin-4-ylethoxy)phenyl]methanone (PubChem CID 18410284) has the molecular formula C27H25NO4S and a molecular weight of 459.57 g/mol. Its IUPAC name is (6-hydroxy-2-phenyl-1-benzothiophen-3-yl)-[4-(2-morpholin-4-ylethoxy)phenyl]methanone.
| Compound Name | (6-hydroxy-2-phenyl-1-benzothiophen-3-yl)-[4-(2-morpholin-4-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 18410284 |
| Molecular Formula | C27H25NO4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | (6-hydroxy-2-phenyl-1-benzothiophen-3-yl)-[4-(2-morpholin-4-ylethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCCN2CCOCC2)cc1)c1c(-c2ccccc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C27H25NO4S/c29-21-8-11-23-24(18-21)33-27(20-4-2-1-3-5-20)25(23)26(30)19-6-9-22(10-7-19)32-17-14-28-12-15-31-16-13-28/h1-11,18,29H,12-17H2 |
| InChIKey | MLURWCKYZHVVBI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |