C30H27NO6S — CID 56983963
1-[2-(4-hydroxyphenyl)-3-[4-(2-morpholin-4-ylethoxy)benzoyl]-1-benzothiophen-6-yl]propane-1,2-dione (PubChem CID 56983963) has the molecular formula C30H27NO6S and a molecular weight of 529.61 g/mol. Its IUPAC name is 1-[2-(4-hydroxyphenyl)-3-[4-(2-morpholin-4-ylethoxy)benzoyl]-1-benzothiophen-6-yl]propane-1,2-dione.
| Compound Name | 1-[2-(4-hydroxyphenyl)-3-[4-(2-morpholin-4-ylethoxy)benzoyl]-1-benzothiophen-6-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 56983963 |
| Molecular Formula | C30H27NO6S |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 1-[2-(4-hydroxyphenyl)-3-[4-(2-morpholin-4-ylethoxy)benzoyl]-1-benzothiophen-6-yl]propane-1,2-dione |
| SMILES | CC(=O)C(=O)c1ccc2c(C(=O)c3ccc(OCCN4CCOCC4)cc3)c(-c3ccc(O)cc3)sc2c1 |
| InChI | InChI=1S/C30H27NO6S/c1-19(32)28(34)22-6-11-25-26(18-22)38-30(21-2-7-23(33)8-3-21)27(25)29(35)20-4-9-24(10-5-20)37-17-14-31-12-15-36-16-13-31/h2-11,18,33H,12-17H2,1H3 |
| InChIKey | ATRMAHBHXPCITQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|