C31H31NO6S — CID 67132403
[4-[6-hydroxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 2-hydroxypropanoate (PubChem CID 67132403) has the molecular formula C31H31NO6S and a molecular weight of 545.66 g/mol. Its IUPAC name is [4-[6-hydroxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 2-hydroxypropanoate.
| Compound Name | [4-[6-hydroxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 2-hydroxypropanoate |
|---|---|
| PubChem CID | 67132403 |
| Molecular Formula | C31H31NO6S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.19 |
| IUPAC Name | [4-[6-hydroxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)Oc1ccc(-c2sc3cc(O)ccc3c2C(=O)c2ccc(OCCN3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C31H31NO6S/c1-20(33)31(36)38-25-12-7-22(8-13-25)30-28(26-14-9-23(34)19-27(26)39-30)29(35)21-5-10-24(11-6-21)37-18-17-32-15-3-2-4-16-32/h5-14,19-20,33-34H,2-4,15-18H2,1H3 |
| InChIKey | DVZDNMROSYBLNM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|