C24H27NO3S — CID 10573580
(2-ethyl-6-hydroxy-1-benzothiophen-3-yl)-[4-(2-piperidin-1-ylethoxy)phenyl]methanone (PubChem CID 10573580) has the molecular formula C24H27NO3S and a molecular weight of 409.55 g/mol. Its IUPAC name is (2-ethyl-6-hydroxy-1-benzothiophen-3-yl)-[4-(2-piperidin-1-ylethoxy)phenyl]methanone.
| Compound Name | (2-ethyl-6-hydroxy-1-benzothiophen-3-yl)-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 10573580 |
| Molecular Formula | C24H27NO3S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (2-ethyl-6-hydroxy-1-benzothiophen-3-yl)-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
| SMILES | CCc1sc2cc(O)ccc2c1C(=O)c1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C24H27NO3S/c1-2-21-23(20-11-8-18(26)16-22(20)29-21)24(27)17-6-9-19(10-7-17)28-15-14-25-12-4-3-5-13-25/h6-11,16,26H,2-5,12-15H2,1H3 |
| InChIKey | GWSCNWNCOYEDTN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |