C28H33NO12P2S — CID 87443248
[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone;phosphoric acid (PubChem CID 87443248) has the molecular formula C28H33NO12P2S and a molecular weight of 669.58 g/mol. Its IUPAC name is [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone;phosphoric acid.
| Compound Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone;phosphoric acid |
|---|---|
| PubChem CID | 87443248 |
| Molecular Formula | C28H33NO12P2S |
| Molecular Weight | 669.58 g/mol |
| Exact Mass | 669.12 |
| IUPAC Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone;phosphoric acid |
| SMILES | O=C(c1ccc(OCCN2CCCCC2)cc1)c1c(-c2ccc(O)cc2)sc2cc(O)ccc12.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C28H27NO4S.2H3O4P/c30-21-8-4-20(5-9-21)28-26(24-13-10-22(31)18-25(24)34-28)27(32)19-6-11-23(12-7-19)33-17-16-29-14-2-1-3-15-29;2*1-5(2,3)4/h4-13,18,30-31H,1-3,14-17H2;2*(H3,1,2,3,4) |
| InChIKey | MIFCXTJIRXLIFA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 225.52 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|