C44H40ClNO6S — CID 22222802
[4-[6-(4-methylbenzoyl)oxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 4-methylbenzoate;hydrochloride (PubChem CID 22222802) has the molecular formula C44H40ClNO6S and a molecular weight of 746.33 g/mol. Its IUPAC name is [4-[6-(4-methylbenzoyl)oxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 4-methylbenzoate;hydrochloride.
| Compound Name | [4-[6-(4-methylbenzoyl)oxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 4-methylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 22222802 |
| Molecular Formula | C44H40ClNO6S |
| Molecular Weight | 746.33 g/mol |
| Exact Mass | 745.23 |
| IUPAC Name | [4-[6-(4-methylbenzoyl)oxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 4-methylbenzoate;hydrochloride |
| SMILES | Cc1ccc(C(=O)Oc2ccc(-c3sc4cc(OC(=O)c5ccc(C)cc5)ccc4c3C(=O)c3ccc(OCCN4CCCCC4)cc3)cc2)cc1.Cl |
| InChI | InChI=1S/C44H39NO6S.ClH/c1-29-6-10-33(11-7-29)43(47)50-36-20-16-32(17-21-36)42-40(41(46)31-14-18-35(19-15-31)49-27-26-45-24-4-3-5-25-45)38-23-22-37(28-39(38)52-42)51-44(48)34-12-8-30(2)9-13-34;/h6-23,28H,3-5,24-27H2,1-2H3;1H |
| InChIKey | NQGNQDLZWJOXTH-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.33 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|