C42H35NO8S — CID 66551061
[4-[6-(2-hydroxybenzoyl)oxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 2-hydroxybenzoate (PubChem CID 66551061) has the molecular formula C42H35NO8S and a molecular weight of 713.81 g/mol. Its IUPAC name is [4-[6-(2-hydroxybenzoyl)oxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 2-hydroxybenzoate.
| Compound Name | [4-[6-(2-hydroxybenzoyl)oxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 66551061 |
| Molecular Formula | C42H35NO8S |
| Molecular Weight | 713.81 g/mol |
| Exact Mass | 713.21 |
| IUPAC Name | [4-[6-(2-hydroxybenzoyl)oxy-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] 2-hydroxybenzoate |
| SMILES | O=C(Oc1ccc(-c2sc3cc(OC(=O)c4ccccc4O)ccc3c2C(=O)c2ccc(OCCN3CCCCC3)cc2)cc1)c1ccccc1O |
| InChI | InChI=1S/C42H35NO8S/c44-35-10-4-2-8-32(35)41(47)50-30-18-14-28(15-19-30)40-38(39(46)27-12-16-29(17-13-27)49-25-24-43-22-6-1-7-23-43)34-21-20-31(26-37(34)52-40)51-42(48)33-9-3-5-11-36(33)45/h2-5,8-21,26,44-45H,1,6-7,22-25H2 |
| InChIKey | DXLKPVMBZTYNEN-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.81 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|