C29H29NO3S — CID 10648095
(6-methoxy-2-phenyl-1-benzothiophen-3-yl)-[4-(2-piperidin-1-ylethoxy)phenyl]methanone (PubChem CID 10648095) has the molecular formula C29H29NO3S and a molecular weight of 471.62 g/mol. Its IUPAC name is (6-methoxy-2-phenyl-1-benzothiophen-3-yl)-[4-(2-piperidin-1-ylethoxy)phenyl]methanone.
| Compound Name | (6-methoxy-2-phenyl-1-benzothiophen-3-yl)-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 10648095 |
| Molecular Formula | C29H29NO3S |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (6-methoxy-2-phenyl-1-benzothiophen-3-yl)-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
| SMILES | COc1ccc2c(C(=O)c3ccc(OCCN4CCCCC4)cc3)c(-c3ccccc3)sc2c1 |
| InChI | InChI=1S/C29H29NO3S/c1-32-24-14-15-25-26(20-24)34-29(22-8-4-2-5-9-22)27(25)28(31)21-10-12-23(13-11-21)33-19-18-30-16-6-3-7-17-30/h2,4-5,8-15,20H,3,6-7,16-19H2,1H3 |
| InChIKey | GPKIORIMKNVYJP-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |