C34H38N2O3S — CID 21183030
[4-(2-pyrrolidin-1-ylethoxy)phenyl]-[2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1-benzothiophen-3-yl]methanone (PubChem CID 21183030) has the molecular formula C34H38N2O3S and a molecular weight of 554.76 g/mol. Its IUPAC name is [4-(2-pyrrolidin-1-ylethoxy)phenyl]-[2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1-benzothiophen-3-yl]methanone.
| Compound Name | [4-(2-pyrrolidin-1-ylethoxy)phenyl]-[2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1-benzothiophen-3-yl]methanone |
|---|---|
| PubChem CID | 21183030 |
| Molecular Formula | C34H38N2O3S |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | [4-(2-pyrrolidin-1-ylethoxy)phenyl]-[2-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-1-benzothiophen-3-yl]methanone |
| SMILES | O=C(c1ccc(OCCN2CCCC2)cc1)c1c(-c2ccc(OCCCN3CCCC3)cc2)sc2ccccc12 |
| InChI | InChI=1S/C34H38N2O3S/c37-33(26-10-14-29(15-11-26)39-25-23-36-20-5-6-21-36)32-30-8-1-2-9-31(30)40-34(32)27-12-16-28(17-13-27)38-24-7-22-35-18-3-4-19-35/h1-2,8-17H,3-7,18-25H2 |
| InChIKey | OLCJFXCCRLZIKK-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|