C32H33NO4S — CID 22753348
[4-[3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] pentanoate (PubChem CID 22753348) has the molecular formula C32H33NO4S and a molecular weight of 527.69 g/mol. Its IUPAC name is [4-[3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] pentanoate.
| Compound Name | [4-[3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] pentanoate |
|---|---|
| PubChem CID | 22753348 |
| Molecular Formula | C32H33NO4S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | [4-[3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] pentanoate |
| SMILES | CCCCC(=O)Oc1ccc(-c2sc3ccccc3c2C(=O)c2ccc(OCCN3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C32H33NO4S/c1-2-3-10-29(34)37-26-17-13-24(14-18-26)32-30(27-8-4-5-9-28(27)38-32)31(35)23-11-15-25(16-12-23)36-22-21-33-19-6-7-20-33/h4-5,8-9,11-18H,2-3,6-7,10,19-22H2,1H3 |
| InChIKey | WFIHEHNSQLAEKO-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|