C45H44N2O11S2 — CID 157355885
bis[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-3-yl]methanone;oxalic acid (PubChem CID 157355885) has the molecular formula C45H44N2O11S2 and a molecular weight of 852.98 g/mol. Its IUPAC name is bis[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-3-yl]methanone;oxalic acid.
| Compound Name | bis[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-3-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 157355885 |
| Molecular Formula | C45H44N2O11S2 |
| Molecular Weight | 852.98 g/mol |
| Exact Mass | 852.24 |
| IUPAC Name | bis[2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-1-benzothiophen-3-yl]methanone;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(O)C(=O)O.O=C(c1c(-c2ccc(OCCN3CCCC3)cc2)sc2ccccc12)c1c(-c2ccc(OCCN3CCCC3)cc2)sc2ccccc12 |
| InChI | InChI=1S/C41H40N2O3S2.2C2H2O4/c44-39(37-33-9-1-3-11-35(33)47-40(37)29-13-17-31(18-14-29)45-27-25-42-21-5-6-22-42)38-34-10-2-4-12-36(34)48-41(38)30-15-19-32(20-16-30)46-28-26-43-23-7-8-24-43;2*3-1(4)2(5)6/h1-4,9-20H,5-8,21-28H2;2*(H,3,4)(H,5,6) |
| InChIKey | BIBPUBBXQMKSJP-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 191.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.98 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|