C37H40N2O10S — CID 76900321
oxalic acid;[4-(piperidin-1-ylmethoxy)phenyl]-[2-[4-(2-pyrrolidin-1-ylethyl)phenyl]-1-benzothiophen-3-yl]methanone (PubChem CID 76900321) has the molecular formula C37H40N2O10S and a molecular weight of 704.80 g/mol. Its IUPAC name is oxalic acid;[4-(piperidin-1-ylmethoxy)phenyl]-[2-[4-(2-pyrrolidin-1-ylethyl)phenyl]-1-benzothiophen-3-yl]methanone.
| Compound Name | oxalic acid;[4-(piperidin-1-ylmethoxy)phenyl]-[2-[4-(2-pyrrolidin-1-ylethyl)phenyl]-1-benzothiophen-3-yl]methanone |
|---|---|
| PubChem CID | 76900321 |
| Molecular Formula | C37H40N2O10S |
| Molecular Weight | 704.80 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | oxalic acid;[4-(piperidin-1-ylmethoxy)phenyl]-[2-[4-(2-pyrrolidin-1-ylethyl)phenyl]-1-benzothiophen-3-yl]methanone |
| SMILES | O=C(O)C(=O)O.O=C(O)C(=O)O.O=C(c1ccc(OCN2CCCCC2)cc1)c1c(-c2ccc(CCN3CCCC3)cc2)sc2ccccc12 |
| InChI | InChI=1S/C33H36N2O2S.2C2H2O4/c36-32(26-14-16-28(17-15-26)37-24-35-21-4-1-5-22-35)31-29-8-2-3-9-30(29)38-33(31)27-12-10-25(11-13-27)18-23-34-19-6-7-20-34;2*3-1(4)2(5)6/h2-3,8-17H,1,4-7,18-24H2;2*(H,3,4)(H,5,6) |
| InChIKey | SYVSMJGCMCBHQA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 181.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.80 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|