C34H29NO4S — CID 22753363
[4-[3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] benzoate (PubChem CID 22753363) has the molecular formula C34H29NO4S and a molecular weight of 547.68 g/mol. Its IUPAC name is [4-[3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] benzoate.
| Compound Name | [4-[3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 22753363 |
| Molecular Formula | C34H29NO4S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | [4-[3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(-c2sc3ccccc3c2C(=O)c2ccc(OCCN3CCCC3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H29NO4S/c36-32(24-12-16-27(17-13-24)38-23-22-35-20-6-7-21-35)31-29-10-4-5-11-30(29)40-33(31)25-14-18-28(19-15-25)39-34(37)26-8-2-1-3-9-26/h1-5,8-19H,6-7,20-23H2 |
| InChIKey | SZRQQZHWWUGCQU-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|