C34H35NO4S — CID 19424311
[2-cyclohexyl-3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] benzoate (PubChem CID 19424311) has the molecular formula C34H35NO4S and a molecular weight of 553.72 g/mol. Its IUPAC name is [2-cyclohexyl-3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] benzoate.
| Compound Name | [2-cyclohexyl-3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] benzoate |
|---|---|
| PubChem CID | 19424311 |
| Molecular Formula | C34H35NO4S |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | [2-cyclohexyl-3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] benzoate |
| SMILES | O=C(Oc1ccc2c(C(=O)c3ccc(OCCN4CCCC4)cc3)c(C3CCCCC3)sc2c1)c1ccccc1 |
| InChI | InChI=1S/C34H35NO4S/c36-32(24-13-15-27(16-14-24)38-22-21-35-19-7-8-20-35)31-29-18-17-28(39-34(37)26-11-5-2-6-12-26)23-30(29)40-33(31)25-9-3-1-4-10-25/h2,5-6,11-18,23,25H,1,3-4,7-10,19-22H2 |
| InChIKey | VKZJOGRTIINAMP-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|