C30H37NO3S — CID 19424273
(2-cyclohexyl-6-methoxy-1-benzothiophen-3-yl)-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone (PubChem CID 19424273) has the molecular formula C30H37NO3S and a molecular weight of 491.70 g/mol. Its IUPAC name is (2-cyclohexyl-6-methoxy-1-benzothiophen-3-yl)-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone.
| Compound Name | (2-cyclohexyl-6-methoxy-1-benzothiophen-3-yl)-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 19424273 |
| Molecular Formula | C30H37NO3S |
| Molecular Weight | 491.70 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (2-cyclohexyl-6-methoxy-1-benzothiophen-3-yl)-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
| SMILES | COc1ccc2c(C(=O)c3ccc(OCCCN4CCCCC4)cc3)c(C3CCCCC3)sc2c1 |
| InChI | InChI=1S/C30H37NO3S/c1-33-25-15-16-26-27(21-25)35-30(23-9-4-2-5-10-23)28(26)29(32)22-11-13-24(14-12-22)34-20-8-19-31-17-6-3-7-18-31/h11-16,21,23H,2-10,17-20H2,1H3 |
| InChIKey | DVVXUUUTBBPDFO-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.70 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|