C31H32FNO4S — CID 19600514
[2-(3-fluoro-4-methoxyphenyl)-6-methoxy-1-benzothiophen-3-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone (PubChem CID 19600514) has the molecular formula C31H32FNO4S and a molecular weight of 533.67 g/mol. Its IUPAC name is [2-(3-fluoro-4-methoxyphenyl)-6-methoxy-1-benzothiophen-3-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone.
| Compound Name | [2-(3-fluoro-4-methoxyphenyl)-6-methoxy-1-benzothiophen-3-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
|---|---|
| PubChem CID | 19600514 |
| Molecular Formula | C31H32FNO4S |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | [2-(3-fluoro-4-methoxyphenyl)-6-methoxy-1-benzothiophen-3-yl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone |
| SMILES | COc1ccc2c(C(=O)c3ccc(OCCCN4CCCCC4)cc3)c(-c3ccc(OC)c(F)c3)sc2c1 |
| InChI | InChI=1S/C31H32FNO4S/c1-35-24-12-13-25-28(20-24)38-31(22-9-14-27(36-2)26(32)19-22)29(25)30(34)21-7-10-23(11-8-21)37-18-6-17-33-15-4-3-5-16-33/h7-14,19-20H,3-6,15-18H2,1-2H3 |
| InChIKey | WQASJFNDYLFCLG-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|