C48H37NO8S — CID 70184950
[4-[4,6-dibenzoyloxy-3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] benzoate (PubChem CID 70184950) has the molecular formula C48H37NO8S and a molecular weight of 787.89 g/mol. Its IUPAC name is [4-[4,6-dibenzoyloxy-3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] benzoate.
| Compound Name | [4-[4,6-dibenzoyloxy-3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 70184950 |
| Molecular Formula | C48H37NO8S |
| Molecular Weight | 787.89 g/mol |
| Exact Mass | 787.22 |
| IUPAC Name | [4-[4,6-dibenzoyloxy-3-[4-(2-pyrrolidin-1-ylethoxy)benzoyl]-1-benzothiophen-2-yl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(-c2sc3cc(OC(=O)c4ccccc4)cc(OC(=O)c4ccccc4)c3c2C(=O)c2ccc(OCCN3CCCC3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C48H37NO8S/c50-44(32-18-22-37(23-19-32)54-29-28-49-26-10-11-27-49)43-42-40(57-48(53)36-16-8-3-9-17-36)30-39(56-47(52)35-14-6-2-7-15-35)31-41(42)58-45(43)33-20-24-38(25-21-33)55-46(51)34-12-4-1-5-13-34/h1-9,12-25,30-31H,10-11,26-29H2 |
| InChIKey | XUCROGKNWIOFME-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.89 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|