C27H26N2O2S — CID 22462724
[2-(4-aminophenyl)-1-benzothiophen-3-yl]-[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone (PubChem CID 22462724) has the molecular formula C27H26N2O2S and a molecular weight of 442.58 g/mol. Its IUPAC name is [2-(4-aminophenyl)-1-benzothiophen-3-yl]-[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone.
| Compound Name | [2-(4-aminophenyl)-1-benzothiophen-3-yl]-[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 22462724 |
| Molecular Formula | C27H26N2O2S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [2-(4-aminophenyl)-1-benzothiophen-3-yl]-[4-(2-pyrrolidin-1-ylethoxy)phenyl]methanone |
| SMILES | Nc1ccc(-c2sc3ccccc3c2C(=O)c2ccc(OCCN3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C27H26N2O2S/c28-21-11-7-20(8-12-21)27-25(23-5-1-2-6-24(23)32-27)26(30)19-9-13-22(14-10-19)31-18-17-29-15-3-4-16-29/h1-2,5-14H,3-4,15-18,28H2 |
| InChIKey | MBPSIRDZUXTJFG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|