C30H31NO5S2 — CID 20666888
[2-(4-methylphenyl)-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] methanesulfonate (PubChem CID 20666888) has the molecular formula C30H31NO5S2 and a molecular weight of 549.71 g/mol. Its IUPAC name is [2-(4-methylphenyl)-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] methanesulfonate.
| Compound Name | [2-(4-methylphenyl)-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 20666888 |
| Molecular Formula | C30H31NO5S2 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | [2-(4-methylphenyl)-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] methanesulfonate |
| SMILES | Cc1ccc(-c2sc3cc(OS(C)(=O)=O)ccc3c2C(=O)c2ccc(OCCN3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H31NO5S2/c1-21-6-8-23(9-7-21)30-28(26-15-14-25(20-27(26)37-30)36-38(2,33)34)29(32)22-10-12-24(13-11-22)35-19-18-31-16-4-3-5-17-31/h6-15,20H,3-5,16-19H2,1-2H3 |
| InChIKey | QWSPKVSMUXRRRL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|