C30H27ClF3NO5S2 — CID 19362922
[2-(4-chloro-3-methylphenyl)-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] trifluoromethanesulfonate (PubChem CID 19362922) has the molecular formula C30H27ClF3NO5S2 and a molecular weight of 638.13 g/mol. Its IUPAC name is [2-(4-chloro-3-methylphenyl)-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] trifluoromethanesulfonate.
| Compound Name | [2-(4-chloro-3-methylphenyl)-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19362922 |
| Molecular Formula | C30H27ClF3NO5S2 |
| Molecular Weight | 638.13 g/mol |
| Exact Mass | 637.10 |
| IUPAC Name | [2-(4-chloro-3-methylphenyl)-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc(-c2sc3cc(OS(=O)(=O)C(F)(F)F)ccc3c2C(=O)c2ccc(OCCN3CCCCC3)cc2)ccc1Cl |
| InChI | InChI=1S/C30H27ClF3NO5S2/c1-19-17-21(7-12-25(19)31)29-27(24-11-10-23(18-26(24)41-29)40-42(37,38)30(32,33)34)28(36)20-5-8-22(9-6-20)39-16-15-35-13-3-2-4-14-35/h5-12,17-18H,2-4,13-16H2,1H3 |
| InChIKey | ANYCNVFDVAZQOO-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.13 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|