C35H40F3NO6S2Si — CID 19362909
[2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] trifluoromethanesulfonate (PubChem CID 19362909) has the molecular formula C35H40F3NO6S2Si and a molecular weight of 719.92 g/mol. Its IUPAC name is [2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] trifluoromethanesulfonate.
| Compound Name | [2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19362909 |
| Molecular Formula | C35H40F3NO6S2Si |
| Molecular Weight | 719.92 g/mol |
| Exact Mass | 719.20 |
| IUPAC Name | [2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc(-c2sc3cc(OS(=O)(=O)C(F)(F)F)ccc3c2C(=O)c2ccc(OCCN3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C35H40F3NO6S2Si/c1-34(2,3)48(4,5)45-28-11-9-10-25(22-28)33-31(29-17-16-27(23-30(29)46-33)44-47(41,42)35(36,37)38)32(40)24-12-14-26(15-13-24)43-21-20-39-18-7-6-8-19-39/h9-17,22-23H,6-8,18-21H2,1-5H3 |
| InChIKey | VSGFYGCSWOMLMP-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.92 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|