C36H41NO3SSi — CID 10531555
[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-ethynyl-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone (PubChem CID 10531555) has the molecular formula C36H41NO3SSi and a molecular weight of 595.88 g/mol. Its IUPAC name is [2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-ethynyl-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone.
| Compound Name | [2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-ethynyl-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 10531555 |
| Molecular Formula | C36H41NO3SSi |
| Molecular Weight | 595.88 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | [2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-6-ethynyl-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
| SMILES | C#Cc1ccc2c(C(=O)c3ccc(OCCN4CCCCC4)cc3)c(-c3ccc(O[Si](C)(C)C(C)(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C36H41NO3SSi/c1-7-26-11-20-31-32(25-26)41-35(28-14-18-30(19-15-28)40-42(5,6)36(2,3)4)33(31)34(38)27-12-16-29(17-13-27)39-24-23-37-21-9-8-10-22-37/h1,11-20,25H,8-10,21-24H2,2-6H3 |
| InChIKey | LOJFFEPKNJDXFI-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.88 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|