C38H48N2O5SSi — CID 58416625
[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] N-propylcarbamate (PubChem CID 58416625) has the molecular formula C38H48N2O5SSi and a molecular weight of 672.96 g/mol. Its IUPAC name is [2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] N-propylcarbamate.
| Compound Name | [2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] N-propylcarbamate |
|---|---|
| PubChem CID | 58416625 |
| Molecular Formula | C38H48N2O5SSi |
| Molecular Weight | 672.96 g/mol |
| Exact Mass | 672.31 |
| IUPAC Name | [2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-[4-(2-piperidin-1-ylethoxy)benzoyl]-1-benzothiophen-6-yl] N-propylcarbamate |
| SMILES | CCCNC(=O)Oc1ccc2c(C(=O)c3ccc(OCCN4CCCCC4)cc3)c(-c3ccc(O[Si](C)(C)C(C)(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C38H48N2O5SSi/c1-7-21-39-37(42)44-31-19-20-32-33(26-31)46-36(28-13-17-30(18-14-28)45-47(5,6)38(2,3)4)34(32)35(41)27-11-15-29(16-12-27)43-25-24-40-22-9-8-10-23-40/h11-20,26H,7-10,21-25H2,1-6H3,(H,39,42) |
| InChIKey | LDBOXZQNXRWLAB-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.96 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|