C30H29NO5S — CID 19362928
1-[3-[4-[2-(diethylamino)ethoxy]benzoyl]-2-(4-hydroxyphenyl)-1-benzothiophen-6-yl]propane-1,2-dione (PubChem CID 19362928) has the molecular formula C30H29NO5S and a molecular weight of 515.63 g/mol. Its IUPAC name is 1-[3-[4-[2-(diethylamino)ethoxy]benzoyl]-2-(4-hydroxyphenyl)-1-benzothiophen-6-yl]propane-1,2-dione.
| Compound Name | 1-[3-[4-[2-(diethylamino)ethoxy]benzoyl]-2-(4-hydroxyphenyl)-1-benzothiophen-6-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 19362928 |
| Molecular Formula | C30H29NO5S |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 1-[3-[4-[2-(diethylamino)ethoxy]benzoyl]-2-(4-hydroxyphenyl)-1-benzothiophen-6-yl]propane-1,2-dione |
| SMILES | CCN(CC)CCOc1ccc(C(=O)c2c(-c3ccc(O)cc3)sc3cc(C(=O)C(C)=O)ccc23)cc1 |
| InChI | InChI=1S/C30H29NO5S/c1-4-31(5-2)16-17-36-24-13-8-20(9-14-24)29(35)27-25-15-10-22(28(34)19(3)32)18-26(25)37-30(27)21-6-11-23(33)12-7-21/h6-15,18,33H,4-5,16-17H2,1-3H3 |
| InChIKey | UBOUINLFESOCQX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|