C29H31NO4S — CID 144647332
[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-[2-[methyl(pentyl)amino]ethoxy]phenyl]methanone (PubChem CID 144647332) has the molecular formula C29H31NO4S and a molecular weight of 489.64 g/mol. Its IUPAC name is [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-[2-[methyl(pentyl)amino]ethoxy]phenyl]methanone.
| Compound Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-[2-[methyl(pentyl)amino]ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 144647332 |
| Molecular Formula | C29H31NO4S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-[4-[2-[methyl(pentyl)amino]ethoxy]phenyl]methanone |
| SMILES | CCCCCN(C)CCOc1ccc(C(=O)c2c(-c3ccc(O)cc3)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C29H31NO4S/c1-3-4-5-16-30(2)17-18-34-24-13-8-20(9-14-24)28(33)27-25-15-12-23(32)19-26(25)35-29(27)21-6-10-22(31)11-7-21/h6-15,19,31-32H,3-5,16-18H2,1-2H3 |
| InChIKey | CEOTYAMFXWQDKZ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|