C27H21NO6S — CID 15338687
1-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl]pyrrolidine-2,5-dione (PubChem CID 15338687) has the molecular formula C27H21NO6S and a molecular weight of 487.53 g/mol. Its IUPAC name is 1-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 15338687 |
| Molecular Formula | C27H21NO6S |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 1-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(c1ccc(OCCN2C(=O)CCC2=O)cc1)c1c(-c2ccc(O)cc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C27H21NO6S/c29-18-5-1-17(2-6-18)27-25(21-10-7-19(30)15-22(21)35-27)26(33)16-3-8-20(9-4-16)34-14-13-28-23(31)11-12-24(28)32/h1-10,15,29-30H,11-14H2 |
| InChIKey | UKFTVRPYOHJNLM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|