C30H32O4S — CID 149090198
[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-nonoxyphenyl)methanone (PubChem CID 149090198) has the molecular formula C30H32O4S and a molecular weight of 488.65 g/mol. Its IUPAC name is [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-nonoxyphenyl)methanone.
| Compound Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-nonoxyphenyl)methanone |
|---|---|
| PubChem CID | 149090198 |
| Molecular Formula | C30H32O4S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-nonoxyphenyl)methanone |
| SMILES | CCCCCCCCCOc1ccc(C(=O)c2c(-c3ccc(O)cc3)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C30H32O4S/c1-2-3-4-5-6-7-8-19-34-25-16-11-21(12-17-25)29(33)28-26-18-15-24(32)20-27(26)35-30(28)22-9-13-23(31)14-10-22/h9-18,20,31-32H,2-8,19H2,1H3 |
| InChIKey | QSAMDRQGKBORNC-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|