C30H24O7S2 — CID 177266310
2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 177266310) has the molecular formula C30H24O7S2 and a molecular weight of 560.65 g/mol. Its IUPAC name is 2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 177266310 |
| Molecular Formula | C30H24O7S2 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2ccc(C(=O)c3c(-c4ccc(O)cc4)sc4cc(O)ccc34)cc2)cc1 |
| InChI | InChI=1S/C30H24O7S2/c1-19-2-13-25(14-3-19)39(34,35)37-17-16-36-24-11-6-20(7-12-24)29(33)28-26-15-10-23(32)18-27(26)38-30(28)21-4-8-22(31)9-5-21/h2-15,18,31-32H,16-17H2,1H3 |
| InChIKey | MIYLKYVTMISKAM-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|