C23H18O4S — CID 70532518
(4-ethoxyphenyl)-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]methanone (PubChem CID 70532518) has the molecular formula C23H18O4S and a molecular weight of 390.46 g/mol. Its IUPAC name is (4-ethoxyphenyl)-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]methanone.
| Compound Name | (4-ethoxyphenyl)-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]methanone |
|---|---|
| PubChem CID | 70532518 |
| Molecular Formula | C23H18O4S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (4-ethoxyphenyl)-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]methanone |
| SMILES | CCOc1ccc(C(=O)c2c(-c3ccc(O)cc3)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C23H18O4S/c1-2-27-18-10-5-14(6-11-18)22(26)21-19-12-9-17(25)13-20(19)28-23(21)15-3-7-16(24)8-4-15/h3-13,24-25H,2H2,1H3 |
| InChIKey | OWCCZVPFLLHOIL-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |