C26H22O5S — CID 22753274
[4-[6-ethoxy-3-(4-methoxybenzoyl)-1-benzothiophen-2-yl]phenyl] acetate (PubChem CID 22753274) has the molecular formula C26H22O5S and a molecular weight of 446.52 g/mol. Its IUPAC name is [4-[6-ethoxy-3-(4-methoxybenzoyl)-1-benzothiophen-2-yl]phenyl] acetate.
| Compound Name | [4-[6-ethoxy-3-(4-methoxybenzoyl)-1-benzothiophen-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 22753274 |
| Molecular Formula | C26H22O5S |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | [4-[6-ethoxy-3-(4-methoxybenzoyl)-1-benzothiophen-2-yl]phenyl] acetate |
| SMILES | CCOc1ccc2c(C(=O)c3ccc(OC)cc3)c(-c3ccc(OC(C)=O)cc3)sc2c1 |
| InChI | InChI=1S/C26H22O5S/c1-4-30-21-13-14-22-23(15-21)32-26(18-7-11-20(12-8-18)31-16(2)27)24(22)25(28)17-5-9-19(29-3)10-6-17/h5-15H,4H2,1-3H3 |
| InChIKey | QOTMIKKKQKSVCB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|