C22H23BrO3S — CID 15365525
6-bromo-1-[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]hexan-1-one (PubChem CID 15365525) has the molecular formula C22H23BrO3S and a molecular weight of 447.39 g/mol. Its IUPAC name is 6-bromo-1-[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]hexan-1-one.
| Compound Name | 6-bromo-1-[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]hexan-1-one |
|---|---|
| PubChem CID | 15365525 |
| Molecular Formula | C22H23BrO3S |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 6-bromo-1-[6-methoxy-2-(4-methoxyphenyl)-1-benzothiophen-3-yl]hexan-1-one |
| SMILES | COc1ccc(-c2sc3cc(OC)ccc3c2C(=O)CCCCCBr)cc1 |
| InChI | InChI=1S/C22H23BrO3S/c1-25-16-9-7-15(8-10-16)22-21(19(24)6-4-3-5-13-23)18-12-11-17(26-2)14-20(18)27-22/h7-12,14H,3-6,13H2,1-2H3 |
| InChIKey | LOKQRSSJLFASJT-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|