C23H24O5S — CID 19830789
9-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-9-oxononanoic acid (PubChem CID 19830789) has the molecular formula C23H24O5S and a molecular weight of 412.51 g/mol. Its IUPAC name is 9-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-9-oxononanoic acid.
| Compound Name | 9-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-9-oxononanoic acid |
|---|---|
| PubChem CID | 19830789 |
| Molecular Formula | C23H24O5S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 9-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-9-oxononanoic acid |
| SMILES | O=C(O)CCCCCCCC(=O)c1c(-c2ccc(O)cc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C23H24O5S/c24-16-10-8-15(9-11-16)23-22(18-13-12-17(25)14-20(18)29-23)19(26)6-4-2-1-3-5-7-21(27)28/h8-14,24-25H,1-7H2,(H,27,28) |
| InChIKey | XJKFLEKIOQTHNA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|