C30H25F5O6S — CID 22718037
6,6,7,7,7-pentafluoro-2-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl]heptanoic acid (PubChem CID 22718037) has the molecular formula C30H25F5O6S and a molecular weight of 608.58 g/mol. Its IUPAC name is 6,6,7,7,7-pentafluoro-2-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl]heptanoic acid.
| Compound Name | 6,6,7,7,7-pentafluoro-2-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl]heptanoic acid |
|---|---|
| PubChem CID | 22718037 |
| Molecular Formula | C30H25F5O6S |
| Molecular Weight | 608.58 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | 6,6,7,7,7-pentafluoro-2-[2-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]ethyl]heptanoic acid |
| SMILES | O=C(c1ccc(OCCC(CCCC(F)(F)C(F)(F)F)C(=O)O)cc1)c1c(-c2ccc(O)cc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C30H25F5O6S/c31-29(32,30(33,34)35)14-1-2-19(28(39)40)13-15-41-22-10-5-17(6-11-22)26(38)25-23-12-9-21(37)16-24(23)42-27(25)18-3-7-20(36)8-4-18/h3-12,16,19,36-37H,1-2,13-15H2,(H,39,40) |
| InChIKey | VODGHQPPSUPAGR-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.58 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|