C38H39F5O8S — CID 22718074
diethyl 2-[5-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]pentyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate (PubChem CID 22718074) has the molecular formula C38H39F5O8S and a molecular weight of 750.78 g/mol. Its IUPAC name is diethyl 2-[5-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]pentyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate.
| Compound Name | diethyl 2-[5-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]pentyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate |
|---|---|
| PubChem CID | 22718074 |
| Molecular Formula | C38H39F5O8S |
| Molecular Weight | 750.78 g/mol |
| Exact Mass | 750.23 |
| IUPAC Name | diethyl 2-[5-[4-[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophene-3-carbonyl]phenoxy]pentyl]-2-(4,4,5,5,5-pentafluoropentyl)propanedioate |
| SMILES | CCOC(=O)C(CCCCCOc1ccc(C(=O)c2c(-c3ccc(O)cc3)sc3cc(O)ccc23)cc1)(CCCC(F)(F)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C38H39F5O8S/c1-3-49-34(47)36(35(48)50-4-2,20-8-21-37(39,40)38(41,42)43)19-6-5-7-22-51-28-16-11-24(12-17-28)32(46)31-29-18-15-27(45)23-30(29)52-33(31)25-9-13-26(44)14-10-25/h9-18,23,44-45H,3-8,19-22H2,1-2H3 |
| InChIKey | JELVGPQXXWWFJI-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.78 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|