C29H30O4S — CID 171614525
[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-octoxyphenyl)methanone (PubChem CID 171614525) has the molecular formula C29H30O4S and a molecular weight of 474.62 g/mol. Its IUPAC name is [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-octoxyphenyl)methanone.
| Compound Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-octoxyphenyl)methanone |
|---|---|
| PubChem CID | 171614525 |
| Molecular Formula | C29H30O4S |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-octoxyphenyl)methanone |
| SMILES | CCCCCCCCOc1ccc(C(=O)c2c(-c3ccc(O)cc3)sc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C29H30O4S/c1-2-3-4-5-6-7-18-33-24-15-10-20(11-16-24)28(32)27-25-17-14-23(31)19-26(25)34-29(27)21-8-12-22(30)13-9-21/h8-17,19,30-31H,2-7,18H2,1H3 |
| InChIKey | TTYWRGXFQVOYGZ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|