C22H16O3S — CID 18318529
[2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-methoxyphenyl)methanone (PubChem CID 18318529) has the molecular formula C22H16O3S and a molecular weight of 360.43 g/mol. Its IUPAC name is [2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 18318529 |
| Molecular Formula | C22H16O3S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2c(-c3ccc(O)cc3)sc3ccccc23)cc1 |
| InChI | InChI=1S/C22H16O3S/c1-25-17-12-8-14(9-13-17)21(24)20-18-4-2-3-5-19(18)26-22(20)15-6-10-16(23)11-7-15/h2-13,23H,1H3 |
| InChIKey | ZHPXXBZHORWYTG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |