C32H32F3NO4 — CID 58882023
4-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-7-hydroxy-3-[4-methyl-2-(trifluoromethyl)phenyl]chromen-2-one (PubChem CID 58882023) has the molecular formula C32H32F3NO4 and a molecular weight of 551.61 g/mol. Its IUPAC name is 4-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-7-hydroxy-3-[4-methyl-2-(trifluoromethyl)phenyl]chromen-2-one.
| Compound Name | 4-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-7-hydroxy-3-[4-methyl-2-(trifluoromethyl)phenyl]chromen-2-one |
|---|---|
| PubChem CID | 58882023 |
| Molecular Formula | C32H32F3NO4 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | 4-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-7-hydroxy-3-[4-methyl-2-(trifluoromethyl)phenyl]chromen-2-one |
| SMILES | Cc1ccc(-c2c(Cc3ccc(OCCN4CCCCCC4)cc3)c3ccc(O)cc3oc2=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H32F3NO4/c1-21-6-12-26(28(18-21)32(33,34)35)30-27(25-13-9-23(37)20-29(25)40-31(30)38)19-22-7-10-24(11-8-22)39-17-16-36-14-4-2-3-5-15-36/h6-13,18,20,37H,2-5,14-17,19H2,1H3 |
| InChIKey | XZYLBZQRCFIMOR-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|