C31H33NO6S — CID 18721859
7-methylperoxysulfanyloxy-3-(4-methylphenyl)-4-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]chromen-2-one (PubChem CID 18721859) has the molecular formula C31H33NO6S and a molecular weight of 547.67 g/mol. Its IUPAC name is 7-methylperoxysulfanyloxy-3-(4-methylphenyl)-4-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]chromen-2-one.
| Compound Name | 7-methylperoxysulfanyloxy-3-(4-methylphenyl)-4-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 18721859 |
| Molecular Formula | C31H33NO6S |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 7-methylperoxysulfanyloxy-3-(4-methylphenyl)-4-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]chromen-2-one |
| SMILES | COOSOc1ccc2c(Cc3ccc(OCCN4CCCCC4)cc3)c(-c3ccc(C)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C31H33NO6S/c1-22-6-10-24(11-7-22)30-28(27-15-14-26(37-39-38-34-2)21-29(27)36-31(30)33)20-23-8-12-25(13-9-23)35-19-18-32-16-4-3-5-17-32/h6-15,21H,3-5,16-20H2,1-2H3 |
| InChIKey | BZZZYJUFCFHVOH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 70.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|