C30H31NO4 — CID 15547179
7-methoxy-3-phenyl-4-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]chromen-2-one (PubChem CID 15547179) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is 7-methoxy-3-phenyl-4-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]chromen-2-one.
| Compound Name | 7-methoxy-3-phenyl-4-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 15547179 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 7-methoxy-3-phenyl-4-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]chromen-2-one |
| SMILES | COc1ccc2c(Cc3ccc(OCCN4CCCCC4)cc3)c(-c3ccccc3)c(=O)oc2c1 |
| InChI | InChI=1S/C30H31NO4/c1-33-25-14-15-26-27(29(23-8-4-2-5-9-23)30(32)35-28(26)21-25)20-22-10-12-24(13-11-22)34-19-18-31-16-6-3-7-17-31/h2,4-5,8-15,21H,3,6-7,16-20H2,1H3 |
| InChIKey | PSUWRVGLDRNNNC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|