C19H14ClO5- — CID 7447692
2-[7-[(4-chlorophenyl)methoxy]-4-methyl-2-oxochromen-3-yl]acetate (PubChem CID 7447692) has the molecular formula C19H14ClO5- and a molecular weight of 357.77 g/mol. Its IUPAC name is 2-[7-[(4-chlorophenyl)methoxy]-4-methyl-2-oxochromen-3-yl]acetate.
| Compound Name | 2-[7-[(4-chlorophenyl)methoxy]-4-methyl-2-oxochromen-3-yl]acetate |
|---|---|
| PubChem CID | 7447692 |
| Molecular Formula | C19H14ClO5- |
| Molecular Weight | 357.77 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 2-[7-[(4-chlorophenyl)methoxy]-4-methyl-2-oxochromen-3-yl]acetate |
| SMILES | Cc1c(CC(=O)[O-])c(=O)oc2cc(OCc3ccc(Cl)cc3)ccc12 |
| InChI | InChI=1S/C19H15ClO5/c1-11-15-7-6-14(24-10-12-2-4-13(20)5-3-12)8-17(15)25-19(23)16(11)9-18(21)22/h2-8H,9-10H2,1H3,(H,21,22)/p-1 |
| InChIKey | WGEAMUJSZQHZPP-UHFFFAOYSA-M |
| XLogP | 2.63 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.77 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|