C21H20O6 — CID 2927077
3-[7-[(4-methoxyphenyl)methoxy]-4-methyl-2-oxochromen-3-yl]propanoic acid (PubChem CID 2927077) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-[7-[(4-methoxyphenyl)methoxy]-4-methyl-2-oxochromen-3-yl]propanoic acid.
| Compound Name | 3-[7-[(4-methoxyphenyl)methoxy]-4-methyl-2-oxochromen-3-yl]propanoic acid |
|---|---|
| PubChem CID | 2927077 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-[7-[(4-methoxyphenyl)methoxy]-4-methyl-2-oxochromen-3-yl]propanoic acid |
| SMILES | COc1ccc(COc2ccc3c(C)c(CCC(=O)O)c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C21H20O6/c1-13-17-8-7-16(26-12-14-3-5-15(25-2)6-4-14)11-19(17)27-21(24)18(13)9-10-20(22)23/h3-8,11H,9-10,12H2,1-2H3,(H,22,23) |
| InChIKey | MDKUIGQGRBSJLW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|