C25H28O5 — CID 3340544
3-[4-methyl-2-oxo-7-[(2,3,4,5,6-pentamethylphenyl)methoxy]chromen-3-yl]propanoic acid (PubChem CID 3340544) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is 3-[4-methyl-2-oxo-7-[(2,3,4,5,6-pentamethylphenyl)methoxy]chromen-3-yl]propanoic acid.
| Compound Name | 3-[4-methyl-2-oxo-7-[(2,3,4,5,6-pentamethylphenyl)methoxy]chromen-3-yl]propanoic acid |
|---|---|
| PubChem CID | 3340544 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 3-[4-methyl-2-oxo-7-[(2,3,4,5,6-pentamethylphenyl)methoxy]chromen-3-yl]propanoic acid |
| SMILES | Cc1c(C)c(C)c(COc2ccc3c(C)c(CCC(=O)O)c(=O)oc3c2)c(C)c1C |
| InChI | InChI=1S/C25H28O5/c1-13-14(2)16(4)22(17(5)15(13)3)12-29-19-7-8-20-18(6)21(9-10-24(26)27)25(28)30-23(20)11-19/h7-8,11H,9-10,12H2,1-6H3,(H,26,27) |
| InChIKey | JFJPTKMCCOZELF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|