C22H20O7 — CID 135373412
3-[7-[2-(4-methoxyphenyl)-2-oxoethoxy]-4-methyl-2-oxochromen-3-yl]propanoic acid (PubChem CID 135373412) has the molecular formula C22H20O7 and a molecular weight of 396.40 g/mol. Its IUPAC name is 3-[7-[2-(4-methoxyphenyl)-2-oxoethoxy]-4-methyl-2-oxochromen-3-yl]propanoic acid.
| Compound Name | 3-[7-[2-(4-methoxyphenyl)-2-oxoethoxy]-4-methyl-2-oxochromen-3-yl]propanoic acid |
|---|---|
| PubChem CID | 135373412 |
| Molecular Formula | C22H20O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 3-[7-[2-(4-methoxyphenyl)-2-oxoethoxy]-4-methyl-2-oxochromen-3-yl]propanoic acid |
| SMILES | COc1ccc(C(=O)COc2ccc3c(C)c(CCC(=O)O)c(=O)oc3c2)cc1 |
| InChI | InChI=1S/C22H20O7/c1-13-17-8-7-16(11-20(17)29-22(26)18(13)9-10-21(24)25)28-12-19(23)14-3-5-15(27-2)6-4-14/h3-8,11H,9-10,12H2,1-2H3,(H,24,25) |
| InChIKey | HKBPQHCCALQDLC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|