C29H38Cl2N2O4 — CID 90357172
3-[4-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]butoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one;dihydrochloride (PubChem CID 90357172) has the molecular formula C29H38Cl2N2O4 and a molecular weight of 549.54 g/mol. Its IUPAC name is 3-[4-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]butoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one;dihydrochloride.
| Compound Name | 3-[4-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]butoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one;dihydrochloride |
|---|---|
| PubChem CID | 90357172 |
| Molecular Formula | C29H38Cl2N2O4 |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | 3-[4-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]butoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one;dihydrochloride |
| SMILES | COc1cccc(CN2CCN(CCCCOc3ccc4c5c(c(=O)oc4c3)CCCC5)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C29H36N2O4.2ClH/c1-33-23-8-6-7-22(19-23)21-31-16-14-30(15-17-31)13-4-5-18-34-24-11-12-26-25-9-2-3-10-27(25)29(32)35-28(26)20-24;;/h6-8,11-12,19-20H,2-5,9-10,13-18,21H2,1H3;2*1H |
| InChIKey | LHSQNGXYTJZNHA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|