C20H28Cl2N2O3 — CID 20502647
7-[3-(4-aminopiperidin-1-yl)propoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one;dihydrochloride (PubChem CID 20502647) has the molecular formula C20H28Cl2N2O3 and a molecular weight of 415.36 g/mol. Its IUPAC name is 7-[3-(4-aminopiperidin-1-yl)propoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one;dihydrochloride.
| Compound Name | 7-[3-(4-aminopiperidin-1-yl)propoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one;dihydrochloride |
|---|---|
| PubChem CID | 20502647 |
| Molecular Formula | C20H28Cl2N2O3 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 7-[3-(4-aminopiperidin-1-yl)propoxy]-2,3-dihydro-1H-cyclopenta[c]chromen-4-one;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(CCCOc2ccc3c4c(c(=O)oc3c2)CCC4)CC1 |
| InChI | InChI=1S/C20H26N2O3.2ClH/c21-14-7-10-22(11-8-14)9-2-12-24-15-5-6-17-16-3-1-4-18(16)20(23)25-19(17)13-15;;/h5-6,13-14H,1-4,7-12,21H2;2*1H |
| InChIKey | GUCKPAGCTRWKRK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|