C27H31N3O4 — CID 20502650
2-amino-N-[1-[3-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propyl]piperidin-4-yl]benzamide (PubChem CID 20502650) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-amino-N-[1-[3-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propyl]piperidin-4-yl]benzamide.
| Compound Name | 2-amino-N-[1-[3-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 20502650 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-amino-N-[1-[3-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propyl]piperidin-4-yl]benzamide |
| SMILES | Nc1ccccc1C(=O)NC1CCN(CCCOc2ccc3c4c(c(=O)oc3c2)CCC4)CC1 |
| InChI | InChI=1S/C27H31N3O4/c28-24-8-2-1-5-23(24)26(31)29-18-11-14-30(15-12-18)13-4-16-33-19-9-10-21-20-6-3-7-22(20)27(32)34-25(21)17-19/h1-2,5,8-10,17-18H,3-4,6-7,11-16,28H2,(H,29,31) |
| InChIKey | RWKXQZMZCDWFSG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|