C30H38N2O4 — CID 20539723
4-tert-butyl-N-[1-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropyl]piperidin-4-yl]benzamide (PubChem CID 20539723) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropyl]piperidin-4-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[1-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 20539723 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 4-tert-butyl-N-[1-[3-(3,4-dimethyl-2-oxochromen-7-yl)oxypropyl]piperidin-4-yl]benzamide |
| SMILES | Cc1c(C)c2ccc(OCCCN3CCC(NC(=O)c4ccc(C(C)(C)C)cc4)CC3)cc2oc1=O |
| InChI | InChI=1S/C30H38N2O4/c1-20-21(2)29(34)36-27-19-25(11-12-26(20)27)35-18-6-15-32-16-13-24(14-17-32)31-28(33)22-7-9-23(10-8-22)30(3,4)5/h7-12,19,24H,6,13-18H2,1-5H3,(H,31,33) |
| InChIKey | AJGNXHSXAFBIHB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|