C21H29NO4 — CID 155561583
7-[[1-(4-hydroxybutyl)piperidin-4-yl]methoxy]-3,4-dimethylchromen-2-one (PubChem CID 155561583) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 7-[[1-(4-hydroxybutyl)piperidin-4-yl]methoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[[1-(4-hydroxybutyl)piperidin-4-yl]methoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 155561583 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 7-[[1-(4-hydroxybutyl)piperidin-4-yl]methoxy]-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCC3CCN(CCCCO)CC3)cc2oc1=O |
| InChI | InChI=1S/C21H29NO4/c1-15-16(2)21(24)26-20-13-18(5-6-19(15)20)25-14-17-7-10-22(11-8-17)9-3-4-12-23/h5-6,13,17,23H,3-4,7-12,14H2,1-2H3 |
| InChIKey | VTPAGWWPFBCDCN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|