C12H12N4O — CID 43289176
4-[3-(1,2,4-triazol-1-yl)propoxy]benzonitrile (PubChem CID 43289176) has the molecular formula C12H12N4O and a molecular weight of 228.26 g/mol. Its IUPAC name is 4-[3-(1,2,4-triazol-1-yl)propoxy]benzonitrile.
| Compound Name | 4-[3-(1,2,4-triazol-1-yl)propoxy]benzonitrile |
|---|---|
| PubChem CID | 43289176 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4-[3-(1,2,4-triazol-1-yl)propoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCCn2cncn2)cc1 |
| InChI | InChI=1S/C12H12N4O/c13-8-11-2-4-12(5-3-11)17-7-1-6-16-10-14-9-15-16/h2-5,9-10H,1,6-7H2 |
| InChIKey | BCEXMFSJCDBCBM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|